Benzenamine, 5-chloro-2-fluoro-4-nitro-
Modify Date: 2025-09-18 09:23:08
Benzenamine, 5-chloro-2-fluoro-4-nitro- structure
|
Common Name | Benzenamine, 5-chloro-2-fluoro-4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 704-11-0 | Molecular Weight | 190.56000 | |
| Density | 1.591g/cm3 | Boiling Point | 356.3ºC at 760mmHg | |
| Molecular Formula | C6H4ClFN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.3ºC | |
| Name | 5-chloro-2-fluoro-4-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.591g/cm3 |
|---|---|
| Boiling Point | 356.3ºC at 760mmHg |
| Molecular Formula | C6H4ClFN2O2 |
| Molecular Weight | 190.56000 |
| Flash Point | 169.3ºC |
| Exact Mass | 189.99500 |
| PSA | 71.84000 |
| LogP | 3.07390 |
| Index of Refraction | 1.617 |
| InChIKey | CKDVOPJPNALABG-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)c([N+](=O)[O-])cc1F |
|
~%
Benzenamine, 5-... CAS#:704-11-0 |
| Literature: Finger et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 94,95, 97 |
|
~%
Benzenamine, 5-... CAS#:704-11-0 |
| Literature: Finger et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 94,95, 97 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzenamine,5-chloro-2-fluoro-4-nitro |
| 5-chloro-2-fluoro-4-nitro-aniline |
| 5-Chlor-2-fluor-4-nitro-anilin |