oxolan-2-yl(triphenyl)phosphanium,chloride structure
|
Common Name | oxolan-2-yl(triphenyl)phosphanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 70398-34-4 | Molecular Weight | 368.83600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22ClOP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | oxolan-2-yl(triphenyl)phosphanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H22ClOP |
|---|---|
| Molecular Weight | 368.83600 |
| Exact Mass | 368.11000 |
| PSA | 22.82000 |
| LogP | 1.12100 |
| InChIKey | FFEQKJDVHBLZKO-UHFFFAOYSA-M |
| SMILES | [Cl-].c1ccc([P+](c2ccccc2)(c2ccccc2)C2CCCO2)cc1 |
|
~10%
oxolan-2-yl(tri... CAS#:70398-34-4 |
| Literature: Epstein, William W.; Garrossian, Massoud Phosphorus and Sulfur and the Related Elements, 1988 , vol. 35, p. 349 - 352 |
| tetrahydrofuran-2-yl triphenylphosphonium chloride |
| (2-tetrahydrofuranyl)triphenyl phosphonium chloride |
| Phosphonium,triphenyl(tetrahydro-2-furanyl)-,chloride |