2-[[carboxymethyl(nitro)amino]methyl-nitroamino]acetic acid structure
|
Common Name | 2-[[carboxymethyl(nitro)amino]methyl-nitroamino]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 7034-41-5 | Molecular Weight | 252.13900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H8N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[[carboxymethyl(nitro)amino]methyl-nitroamino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5H8N4O8 |
|---|---|
| Molecular Weight | 252.13900 |
| Exact Mass | 252.03400 |
| PSA | 172.72000 |
| InChIKey | YYIGRCZONYLUSE-UHFFFAOYSA-N |
| SMILES | O=C(O)CN(CN(CC(=O)O)[N+](=O)[O-])[N+](=O)[O-] |
|
~%
2-[[carboxymeth... CAS#:7034-41-5 |
| Literature: Denkstein,J.; Kaderabek,V. Collection of Czechoslovak Chemical Communications, 1966 , vol. 31, p. 2928 - 2937 |
|
~%
2-[[carboxymeth... CAS#:7034-41-5 |
| Literature: Denkstein,J.; Kaderabek,V. Collection of Czechoslovak Chemical Communications, 1966 , vol. 31, p. 2928 - 2937 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Glycine,N,N'-methylenebis[N-nitro |
| 3,5-Dinitro-3,5-diazaheptandisaeure |