6-[[2-[bis[2-[(3,5-dichloro-6-oxo-1-cyclohexa-2,4-dienylidene)methylamino]ethyl]amino]ethylamino]methylidene]-2,4-dichloro-cyclohexa-2,4-dien-1-one structure
|
Common Name | 6-[[2-[bis[2-[(3,5-dichloro-6-oxo-1-cyclohexa-2,4-dienylidene)methylamino]ethyl]amino]ethylamino]methylidene]-2,4-dichloro-cyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 70292-82-9 | Molecular Weight | 665.22200 | |
| Density | 1.51g/cm3 | Boiling Point | 657.6ºC at 760 mmHg | |
| Molecular Formula | C27H24Cl6N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 351.5ºC | |
| Name | (6Z)-6-[[2-[bis[2-[[(E)-(3,5-dichloro-6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethyl]amino]ethylamino]methylidene]-2,4-dichlorocyclohexa-2,4-dien-1-one |
|---|
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 657.6ºC at 760 mmHg |
| Molecular Formula | C27H24Cl6N4O3 |
| Molecular Weight | 665.22200 |
| Flash Point | 351.5ºC |
| Exact Mass | 661.99800 |
| PSA | 101.01000 |
| LogP | 7.68290 |
| Index of Refraction | 1.659 |
| InChIKey | WHNWQPRRBATWFX-UHFFFAOYSA-N |
| SMILES | Oc1c(Cl)cc(Cl)cc1C=NCCN(CCN=Cc1cc(Cl)cc(Cl)c1O)CCN=Cc1cc(Cl)cc(Cl)c1O |
|
~%
6-[[2-[bis[2-[(... CAS#:70292-82-9 |
| Literature: Ramesh, Krishnamoorthi; Mukherjee, Rabindranath Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1991 , # 12 p. 3259 - 3262 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |