5-methyl-1-naphthalen-1-yltriazole-4-carboxylic acid structure
|
Common Name | 5-methyl-1-naphthalen-1-yltriazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 70292-10-3 | Molecular Weight | 253.25600 | |
| Density | 1.35g/cm3 | Boiling Point | 524.7ºC at 760 mmHg | |
| Molecular Formula | C14H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.1ºC | |
| Name | 5-methyl-1-naphthalen-1-yltriazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 524.7ºC at 760 mmHg |
| Molecular Formula | C14H11N3O2 |
| Molecular Weight | 253.25600 |
| Flash Point | 271.1ºC |
| Exact Mass | 253.08500 |
| PSA | 68.01000 |
| LogP | 2.42710 |
| Index of Refraction | 1.687 |
| InChIKey | XKCDKNITHGLQBZ-UHFFFAOYSA-N |
| SMILES | Cc1c(C(=O)O)nnn1-c1cccc2ccccc12 |
|
~25%
5-methyl-1-naph... CAS#:70292-10-3 |
| Literature: Dong, Heng-Shan; Dong, Hong-Ru; Zhang, Tong-Qiang Journal of Chemical Crystallography, 2009 , vol. 39, # 1 p. 32 - 35 |
|
~%
5-methyl-1-naph... CAS#:70292-10-3 |
| Literature: Dong, Heng-Shan; Wang, Bin Journal of the Chinese Chemical Society, 2005 , vol. 52, # 1 p. 103 - 108 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-<1>Naphtyl-4-carboxy-5-methyl-1H-<1,2,3>triazol |
| 1H-1,2,3-Triazole-4-carboxylic acid,5-methyl-1-(1-naphthalenyl) |
| 5-Methyl-1-(1-naphthalenyl)-1H-1,2,3-triazole-4-carboxylic acid |
| 5-methyl-1-(1-naphthyl)-1,2,3-triazol-4-carboxylic acid |
| 5-methyl-1-naphthalen-1-yl-1H-[1,2,3]triazole-4-carboxylic acid |
| 1-(1'-naphthyl)-4-carboxy-5-methyl-1H-1,2,3-triazole |