Ronacaleret hydrochloride
Modify Date: 2025-08-24 20:00:41
Ronacaleret hydrochloride structure
|
Common Name | Ronacaleret hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 702686-96-2 | Molecular Weight | 483.97600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H32ClF2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ronacaleret hydrochlorideA potent calcium sensing receptor (CaSR) negative allosteric modulator with IC50 of 146 nM for hCaSR. |
| Name | 3-[3-[(2R)-3-[[1-(2,3-dihydro-1H-inden-2-yl)-2-methylpropan-2-yl]amino]-2-hydroxypropoxy]-4,5-difluorophenyl]propanoic acid,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H32ClF2NO4 |
|---|---|
| Molecular Weight | 483.97600 |
| Exact Mass | 483.19900 |
| PSA | 78.79000 |
| LogP | 5.08790 |
| InChIKey | BQGSCEAKPBWIDI-VEIFNGETSA-N |
| SMILES | CC(C)(CC1Cc2ccccc2C1)NCC(O)COc1cc(CCC(=O)O)cc(F)c1F.Cl |
| Ronacaleret HCl |
| UNII-LZM2DSH251 |
| SB-689A |
| Ronacaleret hydrochloride |