3-O-ethyl 8-O-methyl 2,3-benzodiazepine-3,8-dicarboxylate structure
|
Common Name | 3-O-ethyl 8-O-methyl 2,3-benzodiazepine-3,8-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 70266-29-4 | Molecular Weight | 274.27200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-O-ethyl 8-O-methyl 2,3-benzodiazepine-3,8-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14N2O4 |
|---|---|
| Molecular Weight | 274.27200 |
| Exact Mass | 274.09500 |
| PSA | 68.20000 |
| LogP | 1.62340 |
| InChIKey | TVRPRTRZWHTKJM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1C=Cc2ccc(C(=O)OC)cc2C=N1 |
|
~11%
3-O-ethyl 8-O-m... CAS#:70266-29-4 |
| Literature: Saito, Katsuhiro; Iida, Shigenori; Mukai, Toshio Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 11 p. 3483 - 3487 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| benzo[d][1,2]diazepine-3,8-dicarboxylic acid 3-ethyl ester 8-methyl ester |
| 3H-2,3-Benzodiazepine-3,8-dicarboxylic acid,3-ethyl 8-methyl ester |