tridecafluorohexanesulphonic acid, compound with 2,2'-iminodiethanol (1:1) structure
|
Common Name | tridecafluorohexanesulphonic acid, compound with 2,2'-iminodiethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 70225-16-0 | Molecular Weight | 505.25000 | |
| Density | N/A | Boiling Point | 423.7ºC at 760 mmHg | |
| Molecular Formula | C10H12F13NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210ºC | |
| Name | 2-(2-hydroxyethylamino)ethanol,1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 423.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C10H12F13NO5S |
| Molecular Weight | 505.25000 |
| Flash Point | 210ºC |
| Exact Mass | 505.02300 |
| PSA | 115.24000 |
| LogP | 3.60280 |
| InChIKey | VAWRKOLUZUTBLC-UHFFFAOYSA-N |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.OCC[NH2+]CCO |
| 1-Hexanesulfonic acid,1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-,compd. with 2,2'-iminobis(ethanol) (1:1) |
| Tridecafluorohexanesulphonic acid,compound with 2,2'-iminodiethanol (1:1) |
| 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonic acid-2,2'-iminodiethanol (1:1) |
| EINECS 274-462-9 |
| Tridecafluoro-1-hexanesulfonic acid,compd. with diethanolamine |