3,3,4,4,5,5-hexafluorooxolan-2-one structure
|
Common Name | 3,3,4,4,5,5-hexafluorooxolan-2-one | ||
|---|---|---|---|---|
| CAS Number | 702-35-2 | Molecular Weight | 194.03200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4F6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3,4,4,5,5-hexafluorooxolan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4F6O2 |
|---|---|
| Molecular Weight | 194.03200 |
| Exact Mass | 193.98000 |
| PSA | 26.30000 |
| LogP | 1.40660 |
| InChIKey | JVRUYYNHMKFOIU-UHFFFAOYSA-N |
| SMILES | O=C1OC(F)(F)C(F)(F)C1(F)F |
|
~7%
3,3,4,4,5,5-hex... CAS#:702-35-2 |
| Literature: Asahi Glass Company Ltd. Patent: US4116977 A1, 1978 ; |
|
~%
3,3,4,4,5,5-hex... CAS#:702-35-2 |
| Literature: Asahi Glass Company Ltd. Patent: US4151200 A1, 1979 ; |
|
~%
3,3,4,4,5,5-hex... CAS#:702-35-2 |
| Literature: Asahi Glass Company Ltd. Patent: US4116977 A1, 1978 ; |
|
~%
3,3,4,4,5,5-hex... CAS#:702-35-2 |
| Literature: Jacobs; Bauer Journal of the American Chemical Society, 1959 , vol. 81, p. 606,609 |
| Hexafluor-dihydro-furan-2-on |
| 2(3H)-Furanone,3,3,4,4,5,5-hexafluorodihydro |
| hexafluoro-dihydro-furan-2-one |
| perfluorobutyrolactone |