formaldehyde,2-methylphenol,oxalic acid structure
|
Common Name | formaldehyde,2-methylphenol,oxalic acid | ||
|---|---|---|---|---|
| CAS Number | 70198-25-3 | Molecular Weight | 228.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | formaldehyde,2-methylphenol,oxalic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H12O6 |
|---|---|
| Molecular Weight | 228.19900 |
| Exact Mass | 228.06300 |
| PSA | 111.90000 |
| LogP | 1.30720 |
| InChIKey | BFPGSISCAGFNBW-UHFFFAOYSA-N |
| SMILES | C=O.Cc1ccccc1O.O=C(O)C(=O)O |
| 2-Methylphenol,formaldehyde,ethanedioic acid polymer |
| Ethanedioic acid,polymer with formaldehyde and 2-methylphenol |