Cyclohexanol,1-[1-chloro-1-(phenylsulfinyl)ethyl]- structure
|
Common Name | Cyclohexanol,1-[1-chloro-1-(phenylsulfinyl)ethyl]- | ||
|---|---|---|---|---|
| CAS Number | 70150-91-3 | Molecular Weight | 286.81700 | |
| Density | 1.28g/cm3 | Boiling Point | 445ºC at 760 mmHg | |
| Molecular Formula | C14H19ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.9ºC | |
| Name | 1-[1-(benzenesulfinyl)-1-chloroethyl]cyclohexan-1-ol |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 445ºC at 760 mmHg |
| Molecular Formula | C14H19ClO2S |
| Molecular Weight | 286.81700 |
| Flash Point | 222.9ºC |
| Exact Mass | 286.07900 |
| PSA | 56.51000 |
| LogP | 4.31010 |
| Index of Refraction | 1.607 |
| InChIKey | NNQKFNWGQOMULR-UHFFFAOYSA-N |
| SMILES | CC(Cl)(S(=O)c1ccccc1)C1(O)CCCCC1 |
|
~%
Cyclohexanol,1-... CAS#:70150-91-3 |
| Literature: Durst,T. et al. Canadian Journal of Chemistry, 1979 , vol. 57, p. 258 - 266 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |