AKOS B029140
Modify Date: 2025-08-24 13:26:22
AKOS B029140 structure
|
Common Name | AKOS B029140 | ||
|---|---|---|---|---|
| CAS Number | 701221-57-0 | Molecular Weight | 246.26200 | |
| Density | 1.28g/cm3 | Boiling Point | 491ºC at 760 mmHg | |
| Molecular Formula | C13H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.8ºC | |
| Name | 3-(5-oxo-3-propyl-4H-pyrazol-1-yl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 491ºC at 760 mmHg |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.26200 |
| Flash Point | 250.8ºC |
| Exact Mass | 246.10000 |
| PSA | 69.97000 |
| LogP | 1.77820 |
| Index of Refraction | 1.614 |
| InChIKey | OEGWWGDLMDYAAN-UHFFFAOYSA-N |
| SMILES | CCCC1=NN(c2cccc(C(=O)O)c2)C(=O)C1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hms1592c09 |