2-Chloro-1-[2-(4-fluorophenyl)-1H-indol-3-yl]ethanone structure
|
Common Name | 2-Chloro-1-[2-(4-fluorophenyl)-1H-indol-3-yl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 70093-19-5 | Molecular Weight | 287.71600 | |
| Density | 1.342g/cm3 | Boiling Point | 493.9ºC at 760 mmHg | |
| Molecular Formula | C16H11ClFNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.5ºC | |
| Name | 2-Chloro-1-[2-(4-fluorophenyl)-1H-indol-3-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.342g/cm3 |
|---|---|
| Boiling Point | 493.9ºC at 760 mmHg |
| Molecular Formula | C16H11ClFNO |
| Molecular Weight | 287.71600 |
| Flash Point | 252.5ºC |
| Exact Mass | 287.05100 |
| PSA | 32.86000 |
| LogP | 4.39550 |
| Index of Refraction | 1.648 |
| InChIKey | DOHGMVUWQOAZNV-UHFFFAOYSA-N |
| SMILES | O=C(CCl)c1c(-c2ccc(F)cc2)[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Chloracetyl-2-(4'-fluorphenyl)-indol |
| 3-chloroacetyl-2-(4'-fluorophenyl)indole |
| 2-chloro-1-[2-(4-fluoro-phenyl)-indol-3-yl]-ethanone |