9-(2-chloro-6-fluorobenzyl)-6-methylaminopurine structure
|
Common Name | 9-(2-chloro-6-fluorobenzyl)-6-methylaminopurine | ||
|---|---|---|---|---|
| CAS Number | 70091-21-3 | Molecular Weight | 291.71100 | |
| Density | 1.47g/cm3 | Boiling Point | 496.9ºC at 760mmHg | |
| Molecular Formula | C13H11ClFN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.3ºC | |
| Name | 9-[(2-chloro-6-fluorophenyl)methyl]-N-methylpurin-6-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 496.9ºC at 760mmHg |
| Molecular Formula | C13H11ClFN5 |
| Molecular Weight | 291.71100 |
| Flash Point | 254.3ºC |
| Exact Mass | 291.06900 |
| PSA | 55.63000 |
| LogP | 2.78180 |
| Index of Refraction | 1.687 |
| InChIKey | VAEPQHITLRNBPM-UHFFFAOYSA-N |
| SMILES | CNc1ncnc2c1ncn2Cc1c(F)cccc1Cl |
|
~61%
9-(2-chloro-6-f... CAS#:70091-21-3 |
| Literature: Takeda Chemical Industries, Ltd. Patent: US4189485 A1, 1980 ; |
|
~99%
9-(2-chloro-6-f... CAS#:70091-21-3 |
| Literature: Kohjin Co., Ltd. Patent: US4900826 A1, 1990 ; |
|
~%
9-(2-chloro-6-f... CAS#:70091-21-3 |
| Literature: Kohjin Co., Ltd. Patent: US4900826 A1, 1990 ; |
|
~%
9-(2-chloro-6-f... CAS#:70091-21-3 |
| Literature: Kohjin Co., Ltd. Patent: US4900826 A1, 1990 ; |
|
~73%
9-(2-chloro-6-f... CAS#:70091-21-3 |
| Literature: Imai; Seo European Journal of Medicinal Chemistry, 1980 , vol. 15, # 3 p. 207 - 210 |
|
~%
9-(2-chloro-6-f... CAS#:70091-21-3 |
| Literature: Imai; Seo European Journal of Medicinal Chemistry, 1980 , vol. 15, # 3 p. 207 - 210 |
|
~%
9-(2-chloro-6-f... CAS#:70091-21-3 |
| Literature: Imai; Seo European Journal of Medicinal Chemistry, 1980 , vol. 15, # 3 p. 207 - 210 |
|
~%
9-(2-chloro-6-f... CAS#:70091-21-3 |
| Literature: Imai; Seo European Journal of Medicinal Chemistry, 1980 , vol. 15, # 3 p. 207 - 210 |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| VM 6387 |
| 9-(2-Chloro-6-fluorobenzyl)-6-methylaminopurine |
| [9-(2-chloro-6-fluoro-benzyl)-9H-purin-6-yl]-methyl-amine |
| 9-(2-chloro-6-fluorobenzyl)-N6-methyladenine |
| 9-(2-chloro-6-fluorobenzyl)-n-methyl-9h-purin-6-amine |