oxolane-2,5-dione,prop-2-enyl benzoate,styrene
Modify Date: 2025-11-25 12:27:28
oxolane-2,5-dione,prop-2-enyl benzoate,styrene structure
|
Common Name | oxolane-2,5-dione,prop-2-enyl benzoate,styrene | ||
|---|---|---|---|---|
| CAS Number | 70024-58-7 | Molecular Weight | 366.40700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | oxolane-2,5-dione,prop-2-enyl benzoate,styrene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H22O5 |
|---|---|
| Molecular Weight | 366.40700 |
| Exact Mass | 366.14700 |
| PSA | 69.67000 |
| LogP | 4.20900 |
| InChIKey | UVFGYNUPNGLJJX-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)c1ccccc1.C=Cc1ccccc1.O=C1CCC(=O)O1 |
| 2,5-Furandione,dihydro-,polymer with ethenylbenzene and 2-propen-1-ol,benzoate |