Benzene,1,2,3,4,5,6-hexakis[[[(4-methylphenyl)methyl]thio]methyl]- structure
|
Common Name | Benzene,1,2,3,4,5,6-hexakis[[[(4-methylphenyl)methyl]thio]methyl]- | ||
|---|---|---|---|---|
| CAS Number | 69998-68-1 | Molecular Weight | 979.55600 | |
| Density | 1.177g/cm3 | Boiling Point | 956.3ºC at 760 mmHg | |
| Molecular Formula | C60H66S6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 523.9ºC | |
| Name | 1,2,3,4,5,6-hexakis[(4-methylphenyl)methylsulfanylmethyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.177g/cm3 |
|---|---|
| Boiling Point | 956.3ºC at 760 mmHg |
| Molecular Formula | C60H66S6 |
| Molecular Weight | 979.55600 |
| Flash Point | 523.9ºC |
| Exact Mass | 978.34900 |
| PSA | 151.80000 |
| LogP | 18.13740 |
| Index of Refraction | 1.66 |
| InChIKey | UZXCCMIYSSGTJC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(CSCc2c(CSCc3ccc(C)cc3)c(CSCc3ccc(C)cc3)c(CSCc3ccc(C)cc3)c(CSCc3ccc(C)cc3)c2CSCc2ccc(C)cc2)cc1 |
|
~%
Benzene,1,2,3,4... CAS#:69998-68-1 |
| Literature: Hardy, Andrew D. U.; MacNicol, David D.; Swanson, Stephen; Wilson, Derek R. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1980 , p. 999 - 1005 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| hexakis-(4-methylbenzylthiomethyl)benzene |
| Hexakis(p-methylbenzylthiomethyl)benzol |