2-benzamido-3-(4-fluorophenyl)propanoic acid
Modify Date: 2025-10-04 21:24:20
2-benzamido-3-(4-fluorophenyl)propanoic acid structure
|
Common Name | 2-benzamido-3-(4-fluorophenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 69980-11-6 | Molecular Weight | 287.28600 | |
| Density | 1.289g/cm3 | Boiling Point | 536.3ºC at 760 mmHg | |
| Molecular Formula | C16H14FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.2ºC | |
| Name | 2-benzamido-3-(4-fluorophenyl)propanoic acid |
|---|
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 536.3ºC at 760 mmHg |
| Molecular Formula | C16H14FNO3 |
| Molecular Weight | 287.28600 |
| Flash Point | 278.2ºC |
| Exact Mass | 287.09600 |
| PSA | 66.40000 |
| LogP | 2.64230 |
| Index of Refraction | 1.589 |
| InChIKey | GORRHYQCWLMPBT-UHFFFAOYSA-N |
| SMILES | O=C(NC(Cc1ccc(F)cc1)C(=O)O)c1ccccc1 |
|
~%
2-benzamido-3-(... CAS#:69980-11-6 |
| Literature: Atkinson et al. Archives of Biochemistry, 1951 , vol. 31, p. 205,206 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |