4-Hydroxythio-carbanilide
Modify Date: 2025-09-13 17:18:51
4-Hydroxythio-carbanilide structure
|
Common Name | 4-Hydroxythio-carbanilide | ||
|---|---|---|---|---|
| CAS Number | 6986-80-7 | Molecular Weight | 244.31200 | |
| Density | 1.386g/cm3 | Boiling Point | 405.5ºC at 760 mmHg | |
| Molecular Formula | C13H12N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.1ºC | |
| Name | 1-(4-hydroxyphenyl)-3-phenylthiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.386g/cm3 |
|---|---|
| Boiling Point | 405.5ºC at 760 mmHg |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.31200 |
| Flash Point | 199.1ºC |
| Exact Mass | 244.06700 |
| PSA | 76.38000 |
| LogP | 3.34710 |
| Index of Refraction | 1.784 |
| InChIKey | PWLPSXPCUHUSAT-UHFFFAOYSA-N |
| SMILES | Oc1ccc(NC(=S)Nc2ccccc2)cc1 |
|
~%
4-Hydroxythio-c... CAS#:6986-80-7 |
| Literature: Otterbacher; Whitmore Journal of the American Chemical Society, 1929 , vol. 51, p. 1910 |
|
~%
4-Hydroxythio-c... CAS#:6986-80-7 |
| Literature: Kalckhoff Chemische Berichte, 1883 , vol. 16, p. 374 |
|
~%
4-Hydroxythio-c... CAS#:6986-80-7 |
| Literature: Kalckhoff Chemische Berichte, 1883 , vol. 16, p. 374 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| N-(4-hydroxy-phenyl)-N'-phenyl-thiourea |
| 1-(4-hydroxy-phenyl)-3-phenyl-thiourea |
| CARBANILIDE,4-HYDROXYTHIO |
| N'-Phenyl-N-<4-hydroxy-phenyl>-thioharnstoff |
| PTU 24 |
| 4-Hydroxythio-carbanilide |
| N-Phenyl-N'-(p-hydroxyphenyl)-thioharnstoff |
| N-Phenyl-N'-4-hydroxyphenylthiourea |
| N-(4-Hydroxy-phenyl)-N'-phenyl-thioharnstoff |