phthalic acid, compound with N,N-diethylaniline (1:1)
Modify Date: 2025-08-25 22:11:08
phthalic acid, compound with N,N-diethylaniline (1:1) structure
|
Common Name | phthalic acid, compound with N,N-diethylaniline (1:1) | ||
|---|---|---|---|---|
| CAS Number | 69847-39-8 | Molecular Weight | 315.36400 | |
| Density | N/A | Boiling Point | 378.3ºC at 760 mmHg | |
| Molecular Formula | C18H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.7ºC | |
| Name | N,N-diethylaniline,phthalic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 378.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.36400 |
| Flash Point | 196.7ºC |
| Exact Mass | 315.14700 |
| PSA | 77.84000 |
| LogP | 3.61580 |
| InChIKey | RJILSGJGSRJKDS-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccccc1.O=C(O)c1ccccc1C(=O)O |
| Phthalic acid mono,N,N-diethylalinine salt |
| Phthalic acid,compound with N,N-diethylaniline (1:1) |
| 1,2-Benzenedicarboxylic acid,compd. with N,N-diethylbenzenamine (1:1) |
| EINECS 274-151-8 |
| Diethylaniline,phthalic acid salt (1:1) |