S-(2,4-dioxo-1H-pyrimidin-5-yl) ethanethioate
Modify Date: 2026-07-15 18:05:27
S-(2,4-dioxo-1H-pyrimidin-5-yl) ethanethioate structure
|
Common Name | S-(2,4-dioxo-1H-pyrimidin-5-yl) ethanethioate | ||
|---|---|---|---|---|
| CAS Number | 6984-56-1 | Molecular Weight | 186.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H6N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | S-(2,4-dioxo-1H-pyrimidin-5-yl) ethanethioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H6N2O3S |
|---|---|
| Molecular Weight | 186.19 |
| InChIKey | IWQNSKOABHHPJF-UHFFFAOYSA-N |
| SMILES | CC(=O)Sc1c[nH]c(=O)[nH]c1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of S-(2,4-dioxo-1H-pyrimidin-5-yl) ethanethioate? |
| A: The English name of S-(2,4-dioxo-1H-pyrimidin-5-yl) ethanethioate is S-(2,4-dioxo-1H-pyrimidin-5-yl) ethanethioate. |
| Q: What is the InChIKey of S-(2,4-dioxo-1H-pyrimidin-5-yl) ethanethioate? |
| A: InChIKey of S-(2,4-dioxo-1H-pyrimidin-5-yl) ethanethioate is IWQNSKOABHHPJF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of S-(2,4-dioxo-1H-pyrimidin-5-yl) ethanethioate? |
| A: Molecular weight of S-(2,4-dioxo-1H-pyrimidin-5-yl) ethanethioate is 186.19. |
| Q: What is the SMILES notation of S-(2,4-dioxo-1H-pyrimidin-5-yl) ethanethioate? |
| A: SMILES notation of S-(2,4-dioxo-1H-pyrimidin-5-yl) ethanethioate is CC(=O)Sc1c[nH]c(=O)[nH]c1=O. |
| Q: What is the CAS number of S-(2,4-dioxo-1H-pyrimidin-5-yl) ethanethioate? |
| A: CAS number of S-(2,4-dioxo-1H-pyrimidin-5-yl) ethanethioate is 6984-56-1. |
| Q: What is the molecular formula of S-(2,4-dioxo-1H-pyrimidin-5-yl) ethanethioate? |
| A: Molecular formula of S-(2,4-dioxo-1H-pyrimidin-5-yl) ethanethioate is C6H6N2O3S. |
| Q: What is the Chinese name of 6984-56-1? |
| A: Chinese name of 6984-56-1 is 6984-56-1. |