1-diphenylphosphorylpentan-3-one structure
|
Common Name | 1-diphenylphosphorylpentan-3-one | ||
|---|---|---|---|---|
| CAS Number | 69803-57-2 | Molecular Weight | 286.30500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-diphenylphosphorylpentan-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H19O2P |
|---|---|
| Molecular Weight | 286.30500 |
| Exact Mass | 286.11200 |
| PSA | 43.95000 |
| LogP | 3.36970 |
| InChIKey | GQPRZMXZHHVFOE-UHFFFAOYSA-N |
| SMILES | CCC(=O)CCP(=O)(c1ccccc1)c1ccccc1 |
|
~71%
1-diphenylphosp... CAS#:69803-57-2 |
| Literature: Bell, Andrew; Davidson, Alan H.; Earnshaw, Chris; Norrish, Howard K.; Torr, Richard S.; et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 12 p. 2879 - 2892 |
| 3-Pentanone,1-(diphenylphosphinyl) |
| 1-diphenylphosphinoylpentan-3-one |