Pyrazolo[1,5-a]pyridine-3,4-dicarbonitrile,2-amino-5,7-dimethyl- structure
|
Common Name | Pyrazolo[1,5-a]pyridine-3,4-dicarbonitrile,2-amino-5,7-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 6975-46-8 | Molecular Weight | 211.22300 | |
| Density | 1.34g/cm3 | Boiling Point | 295.9ºC at 760mmHg | |
| Molecular Formula | C11H9N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.8ºC | |
| Name | 2-amino-5,7-dimethylpyrazolo[1,5-a]pyridine-3,4-dicarbonitrile |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 295.9ºC at 760mmHg |
| Molecular Formula | C11H9N5 |
| Molecular Weight | 211.22300 |
| Flash Point | 132.8ºC |
| Exact Mass | 211.08600 |
| PSA | 90.90000 |
| LogP | 1.85786 |
| Index of Refraction | 1.698 |
| InChIKey | AXRRARNKSGSPSC-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)n2nc(N)c(C#N)c2c1C#N |
|
~%
Pyrazolo[1,5-a]... CAS#:6975-46-8 |
| Literature: Taylor; Hartke Journal of the American Chemical Society, 1959 , vol. 81, p. 2452,2455 |
|
~%
Detail
|
| Literature: Taylor; Hartke Journal of the American Chemical Society, 1959 , vol. 81, p. 2452,2455 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |