Cyclohexanecarboxylicacid, 1-[(2-cyanophenyl)methyl]-2-oxo-, ethyl ester structure
|
Common Name | Cyclohexanecarboxylicacid, 1-[(2-cyanophenyl)methyl]-2-oxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6975-01-5 | Molecular Weight | 285.33800 | |
| Density | 1.16g/cm3 | Boiling Point | 424ºC at 760 mmHg | |
| Molecular Formula | C17H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.3ºC | |
| Name | ethyl 1-[(2-cyanophenyl)methyl]-2-oxocyclohexane-1-carboxylate |
|---|
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 424ºC at 760 mmHg |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.33800 |
| Flash Point | 185.3ºC |
| Exact Mass | 285.13600 |
| PSA | 67.16000 |
| LogP | 2.79338 |
| Index of Refraction | 1.544 |
| InChIKey | ZGWOTCZGVPAFCC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(Cc2ccccc2C#N)CCCCC1=O |
|
~%
Cyclohexanecarb... CAS#:6975-01-5 |
| Literature: Herz Journal of the American Chemical Society, 1956 , vol. 78, p. 2529 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |