(1E)-7-[(8Z)-1,6-dihydroxy-3-methyl-7-oxo-8-[(phenethylamino)methylidene]-5-propan-2-yl-naphthalen-2-yl]-3,8-dihydroxy-6-methyl-1-[(phenethylamino)methylidene]-4-propan-2-yl-naphthalen-2-one structure
|
Common Name | (1E)-7-[(8Z)-1,6-dihydroxy-3-methyl-7-oxo-8-[(phenethylamino)methylidene]-5-propan-2-yl-naphthalen-2-yl]-3,8-dihydroxy-6-methyl-1-[(phenethylamino)methylidene]-4-propan-2-yl-naphthalen-2-one | ||
|---|---|---|---|---|
| CAS Number | 6974-00-1 | Molecular Weight | 724.88300 | |
| Density | 1.308g/cm3 | Boiling Point | 928.9ºC at 760 mmHg | |
| Molecular Formula | C46H48N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 515.6ºC | |
| Name | (1E)-7-[(8Z)-1,6-dihydroxy-3-methyl-7-oxo-8-[(2-phenylethylamino)methylidene]-5-propan-2-ylnaphthalen-2-yl]-3,8-dihydroxy-6-methyl-1-[(2-phenylethylamino)methylidene]-4-propan-2-ylnaphthalen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.308g/cm3 |
|---|---|
| Boiling Point | 928.9ºC at 760 mmHg |
| Molecular Formula | C46H48N2O6 |
| Molecular Weight | 724.88300 |
| Flash Point | 515.6ºC |
| Exact Mass | 724.35100 |
| PSA | 146.10000 |
| LogP | 10.08040 |
| Index of Refraction | 1.705 |
| InChIKey | IOMXQZQZJSROPC-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(C(C)C)c(O)c(O)c(C=NCCc3ccccc3)c2c(O)c1-c1c(C)cc2c(C(C)C)c(O)c(O)c(C=NCCc3ccccc3)c2c1O |
|
~%
(1E)-7-[(8Z)-1,... CAS#:6974-00-1 |
| Literature: Alley; Shirley Journal of Organic Chemistry, 1959 , vol. 24, p. 1534 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Gossypol-bis-phenaethylimin |