9H-Fluoren-1-ol,4-nitro- structure
|
Common Name | 9H-Fluoren-1-ol,4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 6972-03-8 | Molecular Weight | 227.21500 | |
| Density | 1.432g/cm3 | Boiling Point | 436ºC at 760mmHg | |
| Molecular Formula | C13H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.5ºC | |
| Name | 4-nitro-9H-fluoren-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.432g/cm3 |
|---|---|
| Boiling Point | 436ºC at 760mmHg |
| Molecular Formula | C13H9NO3 |
| Molecular Weight | 227.21500 |
| Flash Point | 190.5ºC |
| Exact Mass | 227.05800 |
| PSA | 66.05000 |
| LogP | 3.39480 |
| Index of Refraction | 1.713 |
| InChIKey | BNKUHAGZBRYQJY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(O)c2c1-c1ccccc1C2 |
|
~%
9H-Fluoren-1-ol... CAS#:6972-03-8 |
| Literature: Weisburger; Weisburger Journal of Organic Chemistry, 1953 , vol. 18, p. 964,966 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 9H-Fluoren-1-ol,4-nitro |
| 4-nitro-fluoren-1-ol |