[4-(2-nitrobutan-2-yl)phenyl]-phenylmethanone
Modify Date: 2025-09-13 22:55:59
![[4-(2-nitrobutan-2-yl)phenyl]-phenylmethanone Structure](https://image.chemsrc.com/caspic/223/69718-95-2.png)
[4-(2-nitrobutan-2-yl)phenyl]-phenylmethanone structure
|
Common Name | [4-(2-nitrobutan-2-yl)phenyl]-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 69718-95-2 | Molecular Weight | 283.32200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-(2-nitrobutan-2-yl)phenyl]-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H17NO3 |
|---|---|
| Molecular Weight | 283.32200 |
| Exact Mass | 283.12100 |
| PSA | 62.89000 |
| LogP | 4.34270 |
| InChIKey | WUIIDEQESTVYRL-UHFFFAOYSA-N |
| SMILES | CCC(C)(c1ccc(C(=O)c2ccccc2)cc1)[N+](=O)[O-] |
|
~%
[4-(2-nitrobuta... CAS#:69718-95-2 |
| Literature: Kornblum,N. et al. Journal of the American Chemical Society, 1979 , vol. 101, # 3 p. 658 - 664 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(p-Benzoylphenyl)-2-nitrobutan |
| 4-(1-METHYL-1-NITROPROPYL)BENZOPHENONE |