Benzenemethanamine,4-chloro-N-[(4-chlorophenyl)methyl]-N-methyl- structure
|
Common Name | Benzenemethanamine,4-chloro-N-[(4-chlorophenyl)methyl]-N-methyl- | ||
|---|---|---|---|---|
| CAS Number | 6970-85-0 | Molecular Weight | 280.19200 | |
| Density | 1.214g/cm3 | Boiling Point | 345.2ºC at 760mmHg | |
| Molecular Formula | C15H15Cl2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.6ºC | |
| Name | 1-(4-chlorophenyl)-N-[(4-chlorophenyl)methyl]-N-methylmethanamine |
|---|
| Density | 1.214g/cm3 |
|---|---|
| Boiling Point | 345.2ºC at 760mmHg |
| Molecular Formula | C15H15Cl2N |
| Molecular Weight | 280.19200 |
| Flash Point | 162.6ºC |
| Exact Mass | 279.05800 |
| PSA | 3.24000 |
| LogP | 4.62540 |
| Index of Refraction | 1.595 |
| InChIKey | QPCPLFFZEHXWIJ-UHFFFAOYSA-N |
| SMILES | CN(Cc1ccc(Cl)cc1)Cc1ccc(Cl)cc1 |
|
~%
Benzenemethanam... CAS#:6970-85-0 |
| Literature: Shapiro et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 3725,3726 |
|
~%
Benzenemethanam... CAS#:6970-85-0 |
| Literature: Baker Journal of the Chemical Society, 1929 , p. 1206 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |