(+-)-cis-11-(ethoxycarbonylmethyl-carbamoyl)-9,10-dihydro-9,10-ethano-anthracene-carboxylic acid-(12)
Modify Date: 2025-09-21 18:10:43
(+-)-cis-11-(ethoxycarbonylmethyl-carbamoyl)-9,10-dihydro-9,10-ethano-anthracene-carboxylic acid-(12) structure
|
Common Name | (+-)-cis-11-(ethoxycarbonylmethyl-carbamoyl)-9,10-dihydro-9,10-ethano-anthracene-carboxylic acid-(12) | ||
|---|---|---|---|---|
| CAS Number | 6968-64-5 | Molecular Weight | 379.40600 | |
| Density | 1.317g/cm3 | Boiling Point | 622.8ºC at 760 mmHg | |
| Molecular Formula | C22H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.5ºC | |
| Name | (+-)-cis-11-(ethoxycarbonylmethyl-carbamoyl)-9,10-dihydro-9,10-ethano-anthracene-carboxylic acid-(12) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.317g/cm3 |
|---|---|
| Boiling Point | 622.8ºC at 760 mmHg |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.40600 |
| Flash Point | 330.5ºC |
| Exact Mass | 379.14200 |
| PSA | 92.70000 |
| LogP | 2.66460 |
| Index of Refraction | 1.613 |
| InChIKey | UWMSOODXOVNKJU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC(=O)C1C2c3ccccc3C(c3ccccc32)C1C(=O)O |
|
~%
(+-)-cis-11-(et... CAS#:6968-64-5 |
| Literature: Bachmann; Cole Journal of Organic Chemistry, 1939 , vol. 4, p. 60,65 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| cis-10-methyl-1,3,7-trioxadecalin |
| (+-)-cis-10-Methyl-1,3,7-trioxa-bicyclo[4.4.0]decan |