N-(3-methanesulfonamidophenyl)methanesulfonamide
Modify Date: 2025-08-23 10:16:43
N-(3-methanesulfonamidophenyl)methanesulfonamide structure
|
Common Name | N-(3-methanesulfonamidophenyl)methanesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 6966-38-7 | Molecular Weight | 264.32200 | |
| Density | 1.551g/cm3 | Boiling Point | 428.9ºC at 760mmHg | |
| Molecular Formula | C8H12N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[3-(methanesulfonamido)phenyl]methanesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.551g/cm3 |
|---|---|
| Boiling Point | 428.9ºC at 760mmHg |
| Molecular Formula | C8H12N2O4S2 |
| Molecular Weight | 264.32200 |
| Exact Mass | 264.02400 |
| PSA | 109.10000 |
| LogP | 2.73720 |
| Index of Refraction | 1.634 |
| InChIKey | PXOGNCFAMBPAMU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)Nc1cccc(NS(C)(=O)=O)c1 |
|
~98%
N-(3-methanesul... CAS#:6966-38-7 |
| Literature: Lis, Randall; Marisca, Anthony J. Journal of Organic Chemistry, 1987 , vol. 52, # 19 p. 4377 - 4379 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| n,n'-1,3-phenylenedimethanesulfonamide |
| N,N'-benzene-1,3-diyldimethanesulfonamide |