Phosphonic acid,[2-(2,4-dichlorophenoxy)ethyl]-, diethyl ester (6CI,9CI) structure
|
Common Name | Phosphonic acid,[2-(2,4-dichlorophenoxy)ethyl]-, diethyl ester (6CI,9CI) | ||
|---|---|---|---|---|
| CAS Number | 6965-48-6 | Molecular Weight | 327.14100 | |
| Density | 1.274g/cm3 | Boiling Point | 416.6ºC at 760mmHg | |
| Molecular Formula | C12H17Cl2O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 324.9ºC | |
| Name | 2,4-dichloro-1-(2-diethoxyphosphorylethoxy)benzene |
|---|
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 416.6ºC at 760mmHg |
| Molecular Formula | C12H17Cl2O4P |
| Molecular Weight | 327.14100 |
| Flash Point | 324.9ºC |
| Exact Mass | 326.02400 |
| PSA | 54.57000 |
| LogP | 4.63830 |
| Index of Refraction | 1.505 |
| InChIKey | XRIGMBSQLGXTIV-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CCOc1ccc(Cl)cc1Cl)OCC |
|
~%
Phosphonic acid... CAS#:6965-48-6 |
| Literature: Boivin et al. Canadian Journal of Chemistry, 1952 , vol. 30, p. 994,995, 996 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |