1(3H)-Isobenzofuranone,3-hydroxy-3-(1-methylethyl)-
Modify Date: 2025-10-28 18:51:02
1(3H)-Isobenzofuranone,3-hydroxy-3-(1-methylethyl)- structure
|
Common Name | 1(3H)-Isobenzofuranone,3-hydroxy-3-(1-methylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 6962-79-4 | Molecular Weight | 192.21100 | |
| Density | 1.251g/cm3 | Boiling Point | 373.4ºC at 760mmHg | |
| Molecular Formula | C11H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.1ºC | |
| Name | 3-hydroxy-3-propan-2-yl-2-benzofuran-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.251g/cm3 |
|---|---|
| Boiling Point | 373.4ºC at 760mmHg |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21100 |
| Flash Point | 167.1ºC |
| Exact Mass | 192.07900 |
| PSA | 46.53000 |
| LogP | 1.65810 |
| Index of Refraction | 1.577 |
| InChIKey | SDWUGFUQYBSGAG-UHFFFAOYSA-N |
| SMILES | CC(C)C1(O)OC(=O)c2ccccc21 |
|
~%
1(3H)-Isobenzof... CAS#:6962-79-4 |
| Literature: Bowden, Keith; Misic-Vukovic, Milica M.; Ranson, Richard J. Collection of Czechoslovak Chemical Communications, 1999 , vol. 64, # 10 p. 1601 - 1606 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 3-Hydroxy-3-isopropylphthalid |