(3,4-dibromo-1-methyl-7-oxabicyclo[4.1.0]heptan-6-yl)-trimethylsilane
Modify Date: 2025-08-25 19:53:22
![(3,4-dibromo-1-methyl-7-oxabicyclo[4.1.0]heptan-6-yl)-trimethylsilane Structure](https://image.chemsrc.com/caspic/292/69616-41-7.png)
(3,4-dibromo-1-methyl-7-oxabicyclo[4.1.0]heptan-6-yl)-trimethylsilane structure
|
Common Name | (3,4-dibromo-1-methyl-7-oxabicyclo[4.1.0]heptan-6-yl)-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 69616-41-7 | Molecular Weight | 342.14300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18Br2OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3,4-dibromo-1-methyl-7-oxabicyclo[4.1.0]heptan-6-yl)-trimethylsilane |
|---|
| Molecular Formula | C10H18Br2OSi |
|---|---|
| Molecular Weight | 342.14300 |
| Exact Mass | 339.94900 |
| PSA | 12.53000 |
| LogP | 4.13220 |
| InChIKey | WQVTVEWOFHRNBK-UHFFFAOYSA-N |
| SMILES | CC12CC(Br)C(Br)CC1([Si](C)(C)C)O2 |
|
~99%
(3,4-dibromo-1-... CAS#:69616-41-7 |
| Literature: Epp, James E. Van; Boyd, Derek R.; Berchtold, Glenn A. Journal of Organic Chemistry, 1981 , vol. 46, # 9 p. 1817 - 1820 |
|
~%
(3,4-dibromo-1-... CAS#:69616-41-7 |
| Literature: Epp, James E. Van; Boyd, Derek R.; Berchtold, Glenn A. Journal of Organic Chemistry, 1981 , vol. 46, # 9 p. 1817 - 1820 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |