1,3-Propanedione,1-(6-hydroxy-2,3,4-trimethoxyphenyl)-3-phenyl- structure
|
Common Name | 1,3-Propanedione,1-(6-hydroxy-2,3,4-trimethoxyphenyl)-3-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 6959-90-6 | Molecular Weight | 330.33200 | |
| Density | 1.235g/cm3 | Boiling Point | 532.8ºC at 760 mmHg | |
| Molecular Formula | C18H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193ºC | |
| Name | 1-(6-hydroxy-2,3,4-trimethoxyphenyl)-3-phenylpropane-1,3-dione |
|---|
| Density | 1.235g/cm3 |
|---|---|
| Boiling Point | 532.8ºC at 760 mmHg |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.33200 |
| Flash Point | 193ºC |
| Exact Mass | 330.11000 |
| PSA | 82.06000 |
| LogP | 2.87370 |
| Index of Refraction | 1.57 |
| InChIKey | GOVULQCPTSDZGA-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c(C(=O)CC(=O)c2ccccc2)c(OC)c1OC |
|
~%
1,3-Propanedion... CAS#:6959-90-6 |
| Literature: Krishnamurti; Seshadri Chemistry and Industry (London, United Kingdom), 1954 , p. 542 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |