cyclohexyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate structure
|
Common Name | cyclohexyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate | ||
|---|---|---|---|---|
| CAS Number | 69578-94-5 | Molecular Weight | 310.77900 | |
| Density | 1.33g/cm3 | Boiling Point | 481.9ºC at 760mmHg | |
| Molecular Formula | C14H19ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.2ºC | |
| Name | cyclohexyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 481.9ºC at 760mmHg |
| Molecular Formula | C14H19ClN4O2 |
| Molecular Weight | 310.77900 |
| Flash Point | 245.2ºC |
| Exact Mass | 310.12000 |
| PSA | 79.70000 |
| LogP | 2.60570 |
| Index of Refraction | 1.614 |
| InChIKey | AKHGKZWAWZSUTL-MHWRWJLKSA-N |
| SMILES | CC(CC(=O)OC1CCCCC1)=NNc1ccc(Cl)nn1 |
|
~69%
cyclohexyl (3E)... CAS#:69578-94-5 |
| Literature: Szilagyi; Kasztreiner; Matyus; et al. European Journal of Medicinal Chemistry, 1984 , vol. 19, # 2 p. 111 - 117 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |