propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate
Modify Date: 2024-09-18 18:44:20
![propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate Structure](https://image.chemsrc.com/caspic/037/69578-90-1.png)
propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate structure
|
Common Name | propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate | ||
|---|---|---|---|---|
| CAS Number | 69578-90-1 | Molecular Weight | 270.71500 | |
| Density | 1.28g/cm3 | Boiling Point | 427.1ºC at 760mmHg | |
| Molecular Formula | C11H15ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.1ºC | |
| Name | propyl (3E)-3-[(6-chloropyridazin-3-yl)hydrazinylidene]butanoate |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 427.1ºC at 760mmHg |
| Molecular Formula | C11H15ClN4O2 |
| Molecular Weight | 270.71500 |
| Flash Point | 212.1ºC |
| Exact Mass | 270.08800 |
| PSA | 79.70000 |
| LogP | 1.68300 |
| Index of Refraction | 1.57 |
| InChIKey | VLQIETABXVBYDB-MDWZMJQESA-N |
| SMILES | CCCOC(=O)CC(C)=NNc1ccc(Cl)nn1 |
|
~%
propyl (3E)-3-[... CAS#:69578-90-1 |
| Literature: Szilagyi; Kasztreiner; Matyus; et al. European Journal of Medicinal Chemistry, 1984 , vol. 19, # 2 p. 111 - 117 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |