[1,2,4]Triazolo[4,3-b]-1,2,4-triazolo[3',4':2,3][1,3,4]thiadiazino[5,6-g][4,1,2]benzothiadiazine,6,13-dichloro-3,10-dimethyl- structure
|
Common Name | [1,2,4]Triazolo[4,3-b]-1,2,4-triazolo[3',4':2,3][1,3,4]thiadiazino[5,6-g][4,1,2]benzothiadiazine,6,13-dichloro-3,10-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 69560-87-8 | Molecular Weight | 397.26600 | |
| Density | 2.21g/cm3 | Boiling Point | 676.5ºC at 760 mmHg | |
| Molecular Formula | C12H6Cl2N8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 362.9ºC | |
| Name | 6,13-dichloro-3,10-dimethylbis<1,2,4>triazolo<3,4-b:3',4'-b'>benzo<1,2-e:4,5-e'>bis<1,3,4>thiadiazine |
|---|
| Density | 2.21g/cm3 |
|---|---|
| Boiling Point | 676.5ºC at 760 mmHg |
| Molecular Formula | C12H6Cl2N8S2 |
| Molecular Weight | 397.26600 |
| Flash Point | 362.9ºC |
| Exact Mass | 395.95300 |
| PSA | 142.64000 |
| LogP | 3.47720 |
| Index of Refraction | 2.11 |
| InChIKey | IPNGGVLIFDQZDO-UHFFFAOYSA-N |
| SMILES | Cc1nnc2sc3c(Cl)c4nn5c(C)nnc5sc4c(Cl)c3nn12 |
|
~%
[1,2,4]Triazolo... CAS#:69560-87-8 |
| Literature: Chadha,V.K. Journal of the Indian Chemical Society, 1978 , vol. 55, p. 817 - 818 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |