Butanamide,N-(4-amino-2-methyl-6-quinolinyl)- structure
|
Common Name | Butanamide,N-(4-amino-2-methyl-6-quinolinyl)- | ||
|---|---|---|---|---|
| CAS Number | 6954-99-0 | Molecular Weight | 243.30400 | |
| Density | 1.207g/cm3 | Boiling Point | 513.3ºC at 760mmHg | |
| Molecular Formula | C14H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.2ºC | |
| Name | N-(4-amino-2-methylquinolin-6-yl)butanamide |
|---|
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 513.3ºC at 760mmHg |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.30400 |
| Flash Point | 264.2ºC |
| Exact Mass | 243.13700 |
| PSA | 68.01000 |
| LogP | 3.51820 |
| Index of Refraction | 1.664 |
| InChIKey | NXUCUQTZLFPZQP-UHFFFAOYSA-N |
| SMILES | CCCC(=O)Nc1ccc2nc(C)cc(N)c2c1 |
|
~%
Butanamide,N-(4... CAS#:6954-99-0 |
| Literature: Peng; Daniels Journal of the American Chemical Society, 1956 , vol. 78, p. 3703,3707 |
|
~%
Butanamide,N-(4... CAS#:6954-99-0 |
| Literature: Lanza, Thomas J.; Durette, Philippe L.; Rollins, Thomas; Siciliano, Salvatore; Cianciarulo, Dana N.; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 2 p. 252 - 258 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |