Butanedioic acid,2-(2-chlorophenyl)-
Modify Date: 2025-11-26 16:11:48
Butanedioic acid,2-(2-chlorophenyl)- structure
|
Common Name | Butanedioic acid,2-(2-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6954-40-1 | Molecular Weight | 228.62900 | |
| Density | 1.454 g/cm3 | Boiling Point | 336.4ºC at 760 mmHg | |
| Molecular Formula | C10H9ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.3ºC | |
| Name | 2-(2-chlorophenyl)butanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.454 g/cm3 |
|---|---|
| Boiling Point | 336.4ºC at 760 mmHg |
| Molecular Formula | C10H9ClO4 |
| Molecular Weight | 228.62900 |
| Flash Point | 157.3ºC |
| Exact Mass | 228.01900 |
| PSA | 74.60000 |
| LogP | 1.98290 |
| Index of Refraction | 1.59 |
| InChIKey | JKZMBINIIFRDHY-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(C(=O)O)c1ccccc1Cl |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| o-Chlorophenylsuccinic acid |
| 2-Chlorophenyl-succinic acid |