(3-methoxy-8,8-dimethyl-4,7,9-trioxabicyclo[4.3.0]non-2-yl) benzoate structure
|
Common Name | (3-methoxy-8,8-dimethyl-4,7,9-trioxabicyclo[4.3.0]non-2-yl) benzoate | ||
|---|---|---|---|---|
| CAS Number | 6953-36-2 | Molecular Weight | 308.32600 | |
| Density | 1.24g/cm3 | Boiling Point | 403.6ºC at 760 mmHg | |
| Molecular Formula | C16H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.1ºC | |
| Name | N-(3-propyl)-N-methylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 403.6ºC at 760 mmHg |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.32600 |
| Flash Point | 177.1ºC |
| Exact Mass | 308.12600 |
| PSA | 63.22000 |
| LogP | 1.73480 |
| Index of Refraction | 1.541 |
| InChIKey | DHMUDVBOXHSKAU-UHFFFAOYSA-N |
| SMILES | COC1OCC2OC(C)(C)OC2C1OC(=O)c1ccccc1 |
|
~%
(3-methoxy-8,8-... CAS#:6953-36-2 |
| Literature: Honeyman Journal of the Chemical Society, 1946 , p. 990,993 |
|
~%
(3-methoxy-8,8-... CAS#:6953-36-2 |
| Literature: Honeyman Journal of the Chemical Society, 1946 , p. 990,993 |
| Benzenamine,N-methyl-N-n-propyl |
| N-methyl-N-propyl-aniline |
| Benzenamine,N-methyl-N-propyl |
| N-methyl-N-propylbenzenamine |
| N-methyl-N-n-propylaniline |
| methyl(n-propyl)phenylamine |
| methyl-phenyl-propyl-amine |