2-(4-hydroxyphenyl)quinoline-4-carboxylic acid
Modify Date: 2025-09-10 19:43:49
2-(4-hydroxyphenyl)quinoline-4-carboxylic acid structure
|
Common Name | 2-(4-hydroxyphenyl)quinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 6952-34-7 | Molecular Weight | 265.26300 | |
| Density | 1.374g/cm3 | Boiling Point | 500.997ºC at 760 mmHg | |
| Molecular Formula | C16H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.794ºC | |
| Name | 2-(4-oxocyclohexa-2,5-dien-1-ylidene)-1H-quinoline-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.374g/cm3 |
|---|---|
| Boiling Point | 500.997ºC at 760 mmHg |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.26300 |
| Flash Point | 256.794ºC |
| Exact Mass | 265.07400 |
| PSA | 70.42000 |
| LogP | 3.30560 |
| Index of Refraction | 1.712 |
| InChIKey | KXZJHVJKXJLBKO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ccc(O)cc2)nc2ccccc12 |
| HS Code | 2933499090 |
|---|
|
~%
2-(4-hydroxyphe... CAS#:6952-34-7 |
| Literature: DE284233 ; |
|
~70%
2-(4-hydroxyphe... CAS#:6952-34-7 |
| Literature: Wang, Li-Min; Hu, Liang; Chen, Hong-Juan; Sui, Yuan-Yuan; Shen, Wei Journal of Fluorine Chemistry, 2009 , vol. 130, # 4 p. 406 - 409 |
|
~%
2-(4-hydroxyphe... CAS#:6952-34-7 |
| Literature: Yakugaku Zasshi, , vol. 50, p. 235,238; dtsch. Ref. S. 31 Chem.Abstr., , p. 3511 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| cinchoninsaeure |
| 2-(4-Hydroxy-phenyl)-quinoline-4-carboxylic acid |
| 2-<4-Hydroxy-phenyl>-4-carboxy-chinolin |
| MFCD00687527 |
| 4-Carboxy-2-<4-hydroxy-phenyl>chinolin |
| 2-(4-Hydroxy-phenyl)-chinolin-4-carbonsaeure |
| 2-(2-METHYLVALERYL)OXAZOLE |