3-(3-methyl-1-piperidyl)-1-phenyl-propan-1-one structure
|
Common Name | 3-(3-methyl-1-piperidyl)-1-phenyl-propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 6951-37-7 | Molecular Weight | 231.33300 | |
| Density | 1.001g/cm3 | Boiling Point | 352.7ºC at 760 mmHg | |
| Molecular Formula | C15H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.3ºC | |
| Name | 3-(3-methylpiperidin-1-yl)-1-phenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.001g/cm3 |
|---|---|
| Boiling Point | 352.7ºC at 760 mmHg |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.33300 |
| Flash Point | 126.3ºC |
| Exact Mass | 231.16200 |
| PSA | 20.31000 |
| LogP | 2.92920 |
| Index of Refraction | 1.52 |
| InChIKey | PWJRCBZVIFAULR-UHFFFAOYSA-N |
| SMILES | CC1CCCN(CCC(=O)c2ccccc2)C1 |
|
~66%
3-(3-methyl-1-p... CAS#:6951-37-7 |
| Literature: Angiolini, L.; Bizzarri, P. Costa; Scapini, G.; Tramontini, M. Tetrahedron, 1981 , vol. 37, p. 2137 - 2142 |
|
~73%
3-(3-methyl-1-p... CAS#:6951-37-7 |
| Literature: Angiolini, L.; Bizzarri, P. Costa; Scapini, G.; Tramontini, M. Tetrahedron, 1981 , vol. 37, p. 2137 - 2142 |
|
~%
3-(3-methyl-1-p... CAS#:6951-37-7 |
| Literature: Huang; Hall European Journal of Medicinal Chemistry, 1996 , vol. 31, # 4 p. 281 - 290 |
| 3-(3-methyl-piperidin-1-yl)-1-phenyl-propan-1-one |
| 3-Methylpiperidino-ethylphenylketon |
| HMS3079D06 |
| 3-(3'-methylpiperidino)-1-phenyl-propan-1-one |