1,4-Phthalazinedione, 2,3-dihydro-2-[2-(2-pyridinyl)ethyl]- structure
|
Common Name | 1,4-Phthalazinedione, 2,3-dihydro-2-[2-(2-pyridinyl)ethyl]- | ||
|---|---|---|---|---|
| CAS Number | 6950-36-3 | Molecular Weight | 348.19500 | |
| Density | 1.285g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H14BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2-pyridin-2-ylethyl)-2H-phthalazine-1,4-dione |
|---|
| Density | 1.285g/cm3 |
|---|---|
| Molecular Formula | C15H14BrN3O2 |
| Molecular Weight | 348.19500 |
| Exact Mass | 347.02700 |
| PSA | 67.75000 |
| LogP | 2.28560 |
| Index of Refraction | 1.618 |
| InChIKey | KIOUWFBETGFEGQ-UHFFFAOYSA-N |
| SMILES | Br.O=c1[nH]n(CCc2ccccn2)c(=O)c2ccccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |