ethyl 2-phenylsulfanylquinoline-4-carboxylate structure
|
Common Name | ethyl 2-phenylsulfanylquinoline-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 6949-89-9 | Molecular Weight | 309.38200 | |
| Density | 1.27g/cm3 | Boiling Point | 482.5ºC at 760 mmHg | |
| Molecular Formula | C18H15NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.6ºC | |
| Name | ethyl 2-phenylsulfanylquinoline-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 482.5ºC at 760 mmHg |
| Molecular Formula | C18H15NO2S |
| Molecular Weight | 309.38200 |
| Flash Point | 245.6ºC |
| Exact Mass | 309.08200 |
| PSA | 64.49000 |
| LogP | 4.56270 |
| Index of Refraction | 1.669 |
| InChIKey | RDPLRWZTPJGGDK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(Sc2ccccc2)nc2ccccc12 |
|
~%
ethyl 2-phenyls... CAS#:6949-89-9 |
| Literature: Winstein et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 2714,2716 |
| 2-Phenylmercapto-chinolin-4-carbonsaeure-aethylester |
| ethyl 2-(phenylsulfanyl)quinoline-4-carboxylate |
| 2-phenylsulfanyl-quinoline-4-carboxylic acid ethyl ester |