Benzenesulfonamide,4-[(3-chloro-1,4-dihydro-1,4-dioxo-2-naphthalenyl)amino]- structure
|
Common Name | Benzenesulfonamide,4-[(3-chloro-1,4-dihydro-1,4-dioxo-2-naphthalenyl)amino]- | ||
|---|---|---|---|---|
| CAS Number | 6949-34-4 | Molecular Weight | 362.78800 | |
| Density | 1.61g/cm3 | Boiling Point | 548.6ºC at 760 mmHg | |
| Molecular Formula | C16H11ClN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.6ºC | |
| Name | 4-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.61g/cm3 |
|---|---|
| Boiling Point | 548.6ºC at 760 mmHg |
| Molecular Formula | C16H11ClN2O4S |
| Molecular Weight | 362.78800 |
| Flash Point | 285.6ºC |
| Exact Mass | 362.01300 |
| PSA | 114.71000 |
| LogP | 4.12960 |
| Index of Refraction | 1.715 |
| InChIKey | ZCSWBRADQTXXKX-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc(NC2=C(Cl)C(=O)c3ccccc3C2=O)cc1 |
|
~39%
Benzenesulfonam... CAS#:6949-34-4 |
| Literature: Lawrence, Harshani R.; Kazi, Aslamuzzaman; Luo, Yunting; Kendig, Robert; Ge, Yiyu; Jain, Sanjula; Daniel, Kenyon; Santiago, Daniel; Guida, Wayne C.; Sebti, Said M. Bioorganic and Medicinal Chemistry, 2010 , vol. 18, # 15 p. 5576 - 5592 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-<p-Sulfamoyl-phenylamino>-2-chlor-1.4-naphthochinon |