2H-Indol-2-one,3-[2-(dimethylamino)acetyl]-1,3-dihydro-1-methyl-
Modify Date: 2025-08-26 23:46:25
![2H-Indol-2-one,3-[2-(dimethylamino)acetyl]-1,3-dihydro-1-methyl- Structure](https://image.chemsrc.com/caspic/184/6947-68-8.png)
2H-Indol-2-one,3-[2-(dimethylamino)acetyl]-1,3-dihydro-1-methyl- structure
|
Common Name | 2H-Indol-2-one,3-[2-(dimethylamino)acetyl]-1,3-dihydro-1-methyl- | ||
|---|---|---|---|---|
| CAS Number | 6947-68-8 | Molecular Weight | 232.27800 | |
| Density | 1.175g/cm3 | Boiling Point | 404.9ºC at 760mmHg | |
| Molecular Formula | C13H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.6ºC | |
| Name | 3-[2-(dimethylamino)acetyl]-1-methyl-3H-indol-2-one |
|---|
| Density | 1.175g/cm3 |
|---|---|
| Boiling Point | 404.9ºC at 760mmHg |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.27800 |
| Flash Point | 185.6ºC |
| Exact Mass | 232.12100 |
| PSA | 40.62000 |
| LogP | 0.94230 |
| Index of Refraction | 1.565 |
| InChIKey | VZFMPZXNSCIZHB-UHFFFAOYSA-N |
| SMILES | CN(C)CC(=O)C1C(=O)N(C)c2ccccc21 |
|
~%
2H-Indol-2-one,... CAS#:6947-68-8 |
| Literature: Julian et al. Journal of the American Chemical Society, 1935 , vol. 57, p. 2026,2028 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |