3-Pentyloxy-5-phenyl-1,2,4-triazine structure
|
Common Name | 3-Pentyloxy-5-phenyl-1,2,4-triazine | ||
|---|---|---|---|---|
| CAS Number | 69466-98-4 | Molecular Weight | 243.30400 | |
| Density | 1.084g/cm3 | Boiling Point | 401.3ºC at 760 mmHg | |
| Molecular Formula | C14H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.5ºC | |
| Name | 3-pentoxy-5-phenyl-1,2,4-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 401.3ºC at 760 mmHg |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.30400 |
| Flash Point | 145.5ºC |
| Exact Mass | 243.13700 |
| PSA | 47.90000 |
| LogP | 3.10760 |
| Index of Refraction | 1.539 |
| InChIKey | GBWOVXNOZNKGDR-UHFFFAOYSA-N |
| SMILES | CCCCCOc1nncc(-c2ccccc2)n1 |
|
~%
3-Pentyloxy-5-p... CAS#:69466-98-4 |
| Literature: Heilman; Scozzie; Wayner; Gullo; Ariyan Journal of Pharmaceutical Sciences, 1980 , vol. 69, # 3 p. 282 - 287 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-n-pentoxy-5-phenyl-1,2,4-triazine |
| 3n-Pentoxy-5-phenyl-1,2,4-triazin |