Benzenamine,N,N-dimethyl-4-(4-methyl-1,3-dioxolan-2-yl)- structure
|
Common Name | Benzenamine,N,N-dimethyl-4-(4-methyl-1,3-dioxolan-2-yl)- | ||
|---|---|---|---|---|
| CAS Number | 6946-37-8 | Molecular Weight | 207.26900 | |
| Density | 1.074g/cm3 | Boiling Point | 315.1ºC at 760 mmHg | |
| Molecular Formula | C12H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.6ºC | |
| Name | benzoic acid,3-hexoxypropan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.074g/cm3 |
|---|---|
| Boiling Point | 315.1ºC at 760 mmHg |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.26900 |
| Flash Point | 118.6ºC |
| Exact Mass | 207.12600 |
| PSA | 21.70000 |
| LogP | 2.18650 |
| Index of Refraction | 1.539 |
| InChIKey | JJXDAGJXGOZEGJ-UHFFFAOYSA-N |
| SMILES | CC1COC(c2ccc(N(C)C)cc2)O1 |
| 3-(hexyloxy)propan-1-amine benzoate(1:1) |
| Benzoic acid,compds. with 3-(branched and linear hexyloxy)-1-propanamine |
| 3-Hexyloxypropylamine,benzoate |