Benzene,1-ethoxy-4-(2-nitroethenyl)- structure
|
Common Name | Benzene,1-ethoxy-4-(2-nitroethenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6946-30-1 | Molecular Weight | 193.19900 | |
| Density | 1.155g/cm3 | Boiling Point | 329.3ºC at 760 mmHg | |
| Molecular Formula | C10H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.6ºC | |
| Name | 1-ethoxy-4-[(E)-2-nitroethenyl]benzene |
|---|
| Density | 1.155g/cm3 |
|---|---|
| Boiling Point | 329.3ºC at 760 mmHg |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.19900 |
| Flash Point | 152.6ºC |
| Exact Mass | 193.07400 |
| PSA | 55.05000 |
| LogP | 2.85590 |
| Index of Refraction | 1.569 |
| InChIKey | LCRQRRBRHHLEHO-BQYQJAHWSA-N |
| SMILES | CCOc1ccc(C=C[N+](=O)[O-])cc1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |