[1-[(4-nitrophenyl)methyl]pyridin-1-ium-3-yl] N,N-dimethylcarbamate,bromide structure
|
Common Name | [1-[(4-nitrophenyl)methyl]pyridin-1-ium-3-yl] N,N-dimethylcarbamate,bromide | ||
|---|---|---|---|---|
| CAS Number | 69440-46-6 | Molecular Weight | 382.20900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16BrN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [1-[(4-nitrophenyl)methyl]pyridin-1-ium-3-yl] N,N-dimethylcarbamate,bromide |
|---|
| Molecular Formula | C15H16BrN3O4 |
|---|---|
| Molecular Weight | 382.20900 |
| Exact Mass | 381.03200 |
| PSA | 79.24000 |
| InChIKey | OPCQIHZEANFLOW-UHFFFAOYSA-M |
| SMILES | CN(C)C(=O)Oc1ccc[n+](Cc2ccc([N+](=O)[O-])cc2)c1.[Br-] |
|
~%
[1-[(4-nitrophe... CAS#:69440-46-6 |
| Literature: Wuest; Sakal Journal of the American Chemical Society, 1951 , vol. 73, p. 1210,1214 |
|
~%
[1-[(4-nitrophe... CAS#:69440-46-6 |
| Literature: Wuest; Sakal Journal of the American Chemical Society, 1951 , vol. 73, p. 1210,1214 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |