2-(4-methylphenyl)imino-3-pyridin-2-yl-1,3-thiazolidin-4-one
Modify Date: 2024-10-01 20:00:50
2-(4-methylphenyl)imino-3-pyridin-2-yl-1,3-thiazolidin-4-one structure
|
Common Name | 2-(4-methylphenyl)imino-3-pyridin-2-yl-1,3-thiazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 69437-79-2 | Molecular Weight | 283.34800 | |
| Density | 1.28g/cm3 | Boiling Point | 453.1ºC at 760mmHg | |
| Molecular Formula | C15H13N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.8ºC | |
| Name | 2-(4-methylphenyl)imino-3-pyridin-2-yl-1,3-thiazolidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 453.1ºC at 760mmHg |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.34800 |
| Flash Point | 227.8ºC |
| Exact Mass | 283.07800 |
| PSA | 70.86000 |
| LogP | 3.22250 |
| Index of Refraction | 1.675 |
| InChIKey | ZNSMPUJNZAPKBX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=C2SCC(=O)N2c2ccccn2)cc1 |
|
~%
2-(4-methylphen... CAS#:69437-79-2 |
| Literature: Gupta; Nath; Shanker; et al. Journal of the Indian Chemical Society, 1978 , vol. 55, # 8 p. 832 - 834 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-pyridin-2-yl-2-p-tolylimino-thiazolidin-4-one |